C15H19N5O — CID 133462640
2-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 133462640) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 2-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133462640 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(3-morpholin-4-ylpropylamino)imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(NCCCN2CCOCC2)nc2ccccn12 |
| InChI | InChI=1S/C15H19N5O/c16-12-13-15(18-14-4-1-2-7-20(13)14)17-5-3-6-19-8-10-21-11-9-19/h1-2,4,7,17H,3,5-6,8-11H2 |
| InChIKey | ZKZPQPFNFBIULB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|