C18H17N5O — CID 75501853
N-benzyl-3-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]propanamide (PubChem CID 75501853) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-benzyl-3-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]propanamide.
| Compound Name | N-benzyl-3-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 75501853 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-benzyl-3-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]propanamide |
| SMILES | N#Cc1c(NCCC(=O)NCc2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C18H17N5O/c19-12-15-18(22-16-8-4-5-11-23(15)16)20-10-9-17(24)21-13-14-6-2-1-3-7-14/h1-8,11,20H,9-10,13H2,(H,21,24) |
| InChIKey | WXOGJDCGNBYROX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |