C17H17N5O3S — CID 133463158
N-[4-[2-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]ethoxy]phenyl]methanesulfonamide (PubChem CID 133463158) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[4-[2-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]ethoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]ethoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133463158 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[4-[2-[(3-cyanoimidazo[1,2-a]pyridin-2-yl)amino]ethoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OCCNc2nc3ccccn3c2C#N)cc1 |
| InChI | InChI=1S/C17H17N5O3S/c1-26(23,24)21-13-5-7-14(8-6-13)25-11-9-19-17-15(12-18)22-10-3-2-4-16(22)20-17/h2-8,10,19,21H,9,11H2,1H3 |
| InChIKey | IAOVQCUMRFTJJN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|