C16H18N4O3S — CID 154748089
5,6-dimethyl-3-[2-(4-methylsulfonylphenoxy)ethylamino]pyridazine-4-carbonitrile (PubChem CID 154748089) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5,6-dimethyl-3-[2-(4-methylsulfonylphenoxy)ethylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-[2-(4-methylsulfonylphenoxy)ethylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 154748089 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5,6-dimethyl-3-[2-(4-methylsulfonylphenoxy)ethylamino]pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCCOc2ccc(S(C)(=O)=O)cc2)c(C#N)c1C |
| InChI | InChI=1S/C16H18N4O3S/c1-11-12(2)19-20-16(15(11)10-17)18-8-9-23-13-4-6-14(7-5-13)24(3,21)22/h4-7H,8-9H2,1-3H3,(H,18,20) |
| InChIKey | YKIAFNITLYPGSG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|