C13H20N4O — CID 115586277
5,6-dimethyl-3-[2-(2-methylpropoxy)ethylamino]pyridazine-4-carbonitrile (PubChem CID 115586277) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 5,6-dimethyl-3-[2-(2-methylpropoxy)ethylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-[2-(2-methylpropoxy)ethylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 115586277 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5,6-dimethyl-3-[2-(2-methylpropoxy)ethylamino]pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCCOCC(C)C)c(C#N)c1C |
| InChI | InChI=1S/C13H20N4O/c1-9(2)8-18-6-5-15-13-12(7-14)10(3)11(4)16-17-13/h9H,5-6,8H2,1-4H3,(H,15,17) |
| InChIKey | LBWIISUMQVAPTA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|