C15H18BrN3O3S — CID 133452228
N-[4-[2-[(5-bromo-6-methyl-2-pyridinyl)amino]ethoxy]phenyl]methanesulfonamide (PubChem CID 133452228) has the molecular formula C15H18BrN3O3S and a molecular weight of 400.30 g/mol. Its IUPAC name is N-[4-[2-[(5-bromo-6-methyl-2-pyridinyl)amino]ethoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[(5-bromo-6-methyl-2-pyridinyl)amino]ethoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133452228 |
| Molecular Formula | C15H18BrN3O3S |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-[4-[2-[(5-bromo-6-methyl-2-pyridinyl)amino]ethoxy]phenyl]methanesulfonamide |
| SMILES | Cc1nc(NCCOc2ccc(NS(C)(=O)=O)cc2)ccc1Br |
| InChI | InChI=1S/C15H18BrN3O3S/c1-11-14(16)7-8-15(18-11)17-9-10-22-13-5-3-12(4-6-13)19-23(2,20)21/h3-8,19H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | XQEUASDQCZZDSY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|