C17H16Cl2N4O3S — CID 133463157
N-[4-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethoxy]phenyl]methanesulfonamide (PubChem CID 133463157) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is N-[4-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133463157 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[4-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OCCNc2cnc3cc(Cl)c(Cl)cc3n2)cc1 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c1-27(24,25)23-11-2-4-12(5-3-11)26-7-6-20-17-10-21-15-8-13(18)14(19)9-16(15)22-17/h2-5,8-10,23H,6-7H2,1H3,(H,20,22) |
| InChIKey | FERUURBUHKMRSQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|