C17H16Cl2N4O3S — CID 133463044
5-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethyl]-2-methoxybenzenesulfonamide (PubChem CID 133463044) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is 5-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 133463044 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 5-[2-[(6,7-dichloroquinoxalin-2-yl)amino]ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CCNc2cnc3cc(Cl)c(Cl)cc3n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H16Cl2N4O3S/c1-26-15-3-2-10(6-16(15)27(20,24)25)4-5-21-17-9-22-13-7-11(18)12(19)8-14(13)23-17/h2-3,6-9H,4-5H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | YKQPRWCENOWARE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |