C17H18N4O4S — CID 167288063
3-[(6,7-dimethoxyquinoxalin-2-yl)amino]-4-methylbenzenesulfonamide (PubChem CID 167288063) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-[(6,7-dimethoxyquinoxalin-2-yl)amino]-4-methylbenzenesulfonamide.
| Compound Name | 3-[(6,7-dimethoxyquinoxalin-2-yl)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 167288063 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[(6,7-dimethoxyquinoxalin-2-yl)amino]-4-methylbenzenesulfonamide |
| SMILES | COc1cc2ncc(Nc3cc(S(N)(=O)=O)ccc3C)nc2cc1OC |
| InChI | InChI=1S/C17H18N4O4S/c1-10-4-5-11(26(18,22)23)6-12(10)20-17-9-19-13-7-15(24-2)16(25-3)8-14(13)21-17/h4-9H,1-3H3,(H,20,21)(H2,18,22,23) |
| InChIKey | LTIMCEYRZCHFGX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |