C14H13F3N2O3S — CID 167783043
3-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]-4-methylbenzenesulfonamide (PubChem CID 167783043) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is 3-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 167783043 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(-c2cc(S(N)(=O)=O)ccc2C)cnc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O3S/c1-8-3-4-10(23(18,20)21)6-11(8)9-5-12(22-2)13(19-7-9)14(15,16)17/h3-7H,1-2H3,(H2,18,20,21) |
| InChIKey | LWIPGQBWUIJODA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |