C17H16N4O3S2 — CID 166565316
N-(2-methyl-5-sulfamoylphenyl)-2-quinoxalin-2-ylsulfanylacetamide (PubChem CID 166565316) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(2-methyl-5-sulfamoylphenyl)-2-quinoxalin-2-ylsulfanylacetamide.
| Compound Name | N-(2-methyl-5-sulfamoylphenyl)-2-quinoxalin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 166565316 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(2-methyl-5-sulfamoylphenyl)-2-quinoxalin-2-ylsulfanylacetamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC(=O)CSc1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-11-6-7-12(26(18,23)24)8-15(11)20-16(22)10-25-17-9-19-13-4-2-3-5-14(13)21-17/h2-9H,10H2,1H3,(H,20,22)(H2,18,23,24) |
| InChIKey | HEYZIXVESJNNNL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |