C15H17N5O6S2 — CID 124537987
2-[[(5R)-5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-methyl-5-sulfamoylphenyl)acetamide (PubChem CID 124537987) has the molecular formula C15H17N5O6S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[[(5R)-5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-methyl-5-sulfamoylphenyl)acetamide.
| Compound Name | 2-[[(5R)-5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-methyl-5-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 124537987 |
| Molecular Formula | C15H17N5O6S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-[[(5R)-5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-methyl-5-sulfamoylphenyl)acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cc(S(N)(=O)=O)ccc2C)NC1=O |
| InChI | InChI=1S/C15H17N5O6S2/c1-7-3-4-9(28(16,25)26)5-10(7)18-11(22)6-27-15-19-13(23)12(14(24)20-15)17-8(2)21/h3-5,12H,6H2,1-2H3,(H,17,21)(H,18,22)(H2,16,25,26)(H,19,20,23,24) |
| InChIKey | KKDWVXJFYABLOG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|