C12H15N5O3S — CID 61130686
N-(2-methyl-5-sulfamoylphenyl)-3-(triazol-1-yl)propanamide (PubChem CID 61130686) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(2-methyl-5-sulfamoylphenyl)-3-(triazol-1-yl)propanamide.
| Compound Name | N-(2-methyl-5-sulfamoylphenyl)-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 61130686 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(2-methyl-5-sulfamoylphenyl)-3-(triazol-1-yl)propanamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC(=O)CCn1ccnn1 |
| InChI | InChI=1S/C12H15N5O3S/c1-9-2-3-10(21(13,19)20)8-11(9)15-12(18)4-6-17-7-5-14-16-17/h2-3,5,7-8H,4,6H2,1H3,(H,15,18)(H2,13,19,20) |
| InChIKey | RUKZFBZMJYCJJK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |