C15H16N4O3S2 — CID 133423878
2-methoxy-5-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]benzenesulfonamide (PubChem CID 133423878) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-methoxy-5-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133423878 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-methoxy-5-[2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CCNc2ncnc3sccc23)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H16N4O3S2/c1-22-12-3-2-10(8-13(12)24(16,20)21)4-6-17-14-11-5-7-23-15(11)19-9-18-14/h2-3,5,7-9H,4,6H2,1H3,(H2,16,20,21)(H,17,18,19) |
| InChIKey | IKTAQZIGEIYDGA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |