C15H14BrCl2NO3S — CID 3746979
5-bromo-N-[2-(3,4-dichlorophenyl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 3746979) has the molecular formula C15H14BrCl2NO3S and a molecular weight of 439.16 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,4-dichlorophenyl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(3,4-dichlorophenyl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3746979 |
| Molecular Formula | C15H14BrCl2NO3S |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 5-bromo-N-[2-(3,4-dichlorophenyl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2NO3S/c1-22-14-5-3-11(16)9-15(14)23(20,21)19-7-6-10-2-4-12(17)13(18)8-10/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | GBDDINYIJLUIID-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |