C12H19N3O4S — CID 120705717
N-[2-[4-(methanesulfonamido)phenoxy]ethyl]-2-(methylamino)acetamide (PubChem CID 120705717) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[2-[4-(methanesulfonamido)phenoxy]ethyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-[4-(methanesulfonamido)phenoxy]ethyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 120705717 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[2-[4-(methanesulfonamido)phenoxy]ethyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCCOc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19N3O4S/c1-13-9-12(16)14-7-8-19-11-5-3-10(4-6-11)15-20(2,17)18/h3-6,13,15H,7-9H2,1-2H3,(H,14,16) |
| InChIKey | AGTSCJIBBIFMPJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|