C10H14N4O4S2 — CID 89489484
[[2-[4-(methanesulfonamido)phenoxy]acetyl]amino]thiourea (PubChem CID 89489484) has the molecular formula C10H14N4O4S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is [[2-[4-(methanesulfonamido)phenoxy]acetyl]amino]thiourea.
| Compound Name | [[2-[4-(methanesulfonamido)phenoxy]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 89489484 |
| Molecular Formula | C10H14N4O4S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [[2-[4-(methanesulfonamido)phenoxy]acetyl]amino]thiourea |
| SMILES | CS(=O)(=O)Nc1ccc(OCC(=O)NNC(N)=S)cc1 |
| InChI | InChI=1S/C10H14N4O4S2/c1-20(16,17)14-7-2-4-8(5-3-7)18-6-9(15)12-13-10(11)19/h2-5,14H,6H2,1H3,(H,12,15)(H3,11,13,19) |
| InChIKey | MQWZYRQVWWMWFO-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|