C19H24N2O4S — CID 35545211
2-[4-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]phenoxy]acetamide (PubChem CID 35545211) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[4-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]phenoxy]acetamide.
| Compound Name | 2-[4-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 35545211 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]phenoxy]acetamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ccc(OCC(N)=O)cc2)c(C)c1C |
| InChI | InChI=1S/C19H24N2O4S/c1-11-12(2)14(4)19(15(5)13(11)3)26(23,24)21-16-6-8-17(9-7-16)25-10-18(20)22/h6-9,21H,10H2,1-5H3,(H2,20,22) |
| InChIKey | PCAFANZRBDKASF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |