C10H11KN2O4S3 — CID 23674470
potassium N-[[2-(4-methylsulfonylphenoxy)acetyl]amino]carbamodithioate (PubChem CID 23674470) has the molecular formula C10H11KN2O4S3 and a molecular weight of 358.51 g/mol. Its IUPAC name is potassium N-[[2-(4-methylsulfonylphenoxy)acetyl]amino]carbamodithioate.
| Compound Name | potassium N-[[2-(4-methylsulfonylphenoxy)acetyl]amino]carbamodithioate |
|---|---|
| PubChem CID | 23674470 |
| Molecular Formula | C10H11KN2O4S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | potassium N-[[2-(4-methylsulfonylphenoxy)acetyl]amino]carbamodithioate |
| SMILES | CS(=O)(=O)c1ccc(OCC(=O)NNC(=S)[S-])cc1.[K+] |
| InChI | InChI=1S/C10H12N2O4S3.K/c1-19(14,15)8-4-2-7(3-5-8)16-6-9(13)11-12-10(17)18;/h2-5H,6H2,1H3,(H,11,13)(H2,12,17,18);/q;+1/p-1 |
| InChIKey | RRGAICNITKQPBS-UHFFFAOYSA-M |
| XLogP | -3.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|