C21H28N2O3S2 — CID 87803381
2-(4-tert-butylphenoxy)-N-[1-[4-(methanesulfonamido)phenyl]ethyl]ethanethioamide (PubChem CID 87803381) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[1-[4-(methanesulfonamido)phenyl]ethyl]ethanethioamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[1-[4-(methanesulfonamido)phenyl]ethyl]ethanethioamide |
|---|---|
| PubChem CID | 87803381 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[1-[4-(methanesulfonamido)phenyl]ethyl]ethanethioamide |
| SMILES | CC(NC(=S)COc1ccc(C(C)(C)C)cc1)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-15(16-6-10-18(11-7-16)23-28(5,24)25)22-20(27)14-26-19-12-8-17(9-13-19)21(2,3)4/h6-13,15,23H,14H2,1-5H3,(H,22,27) |
| InChIKey | NKKLEOMSAKKLPI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|