C21H27ClN3O5S+ — CID 110171537
2-[[2-(4-chlorophenoxy)acetyl]amino]ethyl-[2-[4-(methanesulfonamido)phenyl]-2-oxoethyl]-dimethylazanium (PubChem CID 110171537) has the molecular formula C21H27ClN3O5S+ and a molecular weight of 468.98 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenoxy)acetyl]amino]ethyl-[2-[4-(methanesulfonamido)phenyl]-2-oxoethyl]-dimethylazanium.
| Compound Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]ethyl-[2-[4-(methanesulfonamido)phenyl]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 110171537 |
| Molecular Formula | C21H27ClN3O5S+ |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]ethyl-[2-[4-(methanesulfonamido)phenyl]-2-oxoethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCNC(=O)COc1ccc(Cl)cc1)CC(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H26ClN3O5S/c1-25(2,13-12-23-21(27)15-30-19-10-6-17(22)7-11-19)14-20(26)16-4-8-18(9-5-16)24-31(3,28)29/h4-11H,12-15H2,1-3H3,(H-,23,24,26,27)/p+1 |
| InChIKey | ILTRYHWTTVZQSV-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|