C10H16BrN3O2S — CID 106070390
N-(5-bromo-6-methyl-2-pyridinyl)-3-(methylamino)propane-1-sulfonamide (PubChem CID 106070390) has the molecular formula C10H16BrN3O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106070390 |
| Molecular Formula | C10H16BrN3O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)Nc1ccc(Br)c(C)n1 |
| InChI | InChI=1S/C10H16BrN3O2S/c1-8-9(11)4-5-10(13-8)14-17(15,16)7-3-6-12-2/h4-5,12H,3,6-7H2,1-2H3,(H,13,14) |
| InChIKey | ZDQOLMOXCGDNSH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|