C14H14BrClN2O2S — CID 79041281
N-(5-bromo-6-methyl-2-pyridinyl)-4-(2-chloroethyl)benzenesulfonamide (PubChem CID 79041281) has the molecular formula C14H14BrClN2O2S and a molecular weight of 389.70 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-4-(2-chloroethyl)benzenesulfonamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-4-(2-chloroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79041281 |
| Molecular Formula | C14H14BrClN2O2S |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-4-(2-chloroethyl)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(CCCl)cc2)ccc1Br |
| InChI | InChI=1S/C14H14BrClN2O2S/c1-10-13(15)6-7-14(17-10)18-21(19,20)12-4-2-11(3-5-12)8-9-16/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | RWKQNCPUEBKQLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|