C18H26Cl2N8O2 — CID 118892550
2,6-dichloro-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine (PubChem CID 118892550) has the molecular formula C18H26Cl2N8O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 2,6-dichloro-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine.
| Compound Name | 2,6-dichloro-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine |
|---|---|
| PubChem CID | 118892550 |
| Molecular Formula | C18H26Cl2N8O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2,6-dichloro-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine |
| SMILES | Clc1nc(NCCN2CCOCC2)c2nc(Cl)c(NCCN3CCOCC3)nc2n1 |
| InChI | InChI=1S/C18H26Cl2N8O2/c19-14-17(22-2-4-28-7-11-30-12-8-28)24-16-13(23-14)15(25-18(20)26-16)21-1-3-27-5-9-29-10-6-27/h1-12H2,(H2,21,22,24,25,26) |
| InChIKey | QPLIFQMETZDAGH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |