C14H18Cl2N6O2S — CID 130466479
6,7-dichloro-2-methylsulfonyl-N-(2-piperidin-1-ylethyl)pteridin-4-amine (PubChem CID 130466479) has the molecular formula C14H18Cl2N6O2S and a molecular weight of 405.31 g/mol. Its IUPAC name is 6,7-dichloro-2-methylsulfonyl-N-(2-piperidin-1-ylethyl)pteridin-4-amine.
| Compound Name | 6,7-dichloro-2-methylsulfonyl-N-(2-piperidin-1-ylethyl)pteridin-4-amine |
|---|---|
| PubChem CID | 130466479 |
| Molecular Formula | C14H18Cl2N6O2S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 6,7-dichloro-2-methylsulfonyl-N-(2-piperidin-1-ylethyl)pteridin-4-amine |
| SMILES | CS(=O)(=O)c1nc(NCCN2CCCCC2)c2nc(Cl)c(Cl)nc2n1 |
| InChI | InChI=1S/C14H18Cl2N6O2S/c1-25(23,24)14-20-12(17-5-8-22-6-3-2-4-7-22)9-13(21-14)19-11(16)10(15)18-9/h2-8H2,1H3,(H,17,19,20,21) |
| InChIKey | KIBUHPHIAPYKOF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |