C21H35ClN8O2 — CID 145022023
6-chloro-2-methyl-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine;ethane (PubChem CID 145022023) has the molecular formula C21H35ClN8O2 and a molecular weight of 467.02 g/mol. Its IUPAC name is 6-chloro-2-methyl-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine;ethane.
| Compound Name | 6-chloro-2-methyl-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine;ethane |
|---|---|
| PubChem CID | 145022023 |
| Molecular Formula | C21H35ClN8O2 |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 6-chloro-2-methyl-4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine;ethane |
| SMILES | CC.Cc1nc(NCCN2CCOCC2)c2nc(Cl)c(NCCN3CCOCC3)nc2n1 |
| InChI | InChI=1S/C19H29ClN8O2.C2H6/c1-14-23-17(21-2-4-27-6-10-29-11-7-27)15-18(24-14)26-19(16(20)25-15)22-3-5-28-8-12-30-13-9-28;1-2/h2-13H2,1H3,(H2,21,22,23,24,26);1-2H3 |
| InChIKey | RZGUYFJXYKEDEG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |