About 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride
2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride (PubChem CID 53312605) has the molecular formula C17H20ClN4O2-
and a molecular weight of 347.83 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride.
Molecular Properties
| Compound Name | 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride |
| PubChem CID | 53312605 |
| Molecular Formula | C17H20ClN4O2- |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride |
| SMILES | Cc1nc(NCCN2CCOCC2)c2oc3ccccc3c2n1.[Cl-] |
| InChI | InChI=1S/C17H20N4O2.ClH/c1-12-19-15-13-4-2-3-5-14(13)23-16(15)17(20-12)18-6-7-21-8-10-22-11-9-21;/h2-5H,6-11H2,1H3,(H,18,19,20);1H/p-1 |
| InChIKey | WLZGGZBXJSHYMB-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride?
The IUPAC name of 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride (CID 53312605) is 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride.
What is the SMILES notation for 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride?
The canonical SMILES for 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride is Cc1nc(NCCN2CCOCC2)c2oc3ccccc3c2n1.[Cl-].
What is the InChIKey of 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride?
The InChIKey is WLZGGZBXJSHYMB-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H20N4O2.ClH/c1-12-19-15-13-4-2-3-5-14(13)23-16(15)17(20-12)18-6-7-21-8-10-22-11-9-21;/h2-5H,6-11H2,1H3,(H,18,19,20);1H/p-1.
What are the key properties of 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride?
2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride has a molecular weight of 347.83 g/mol, XLogP of -0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2-morpholin-4-ylethyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine chloride is sourced from PubChem (CID 53312605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).