C18H28N8O2 — CID 145022020
4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine (PubChem CID 145022020) has the molecular formula C18H28N8O2 and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine.
| Compound Name | 4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine |
|---|---|
| PubChem CID | 145022020 |
| Molecular Formula | C18H28N8O2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 4-N,7-N-bis(2-morpholin-4-ylethyl)pteridine-4,7-diamine |
| SMILES | c1nc(NCCN2CCOCC2)c2ncc(NCCN3CCOCC3)nc2n1 |
| InChI | InChI=1S/C18H28N8O2/c1(3-25-5-9-27-10-6-25)19-15-13-21-16-17(22-14-23-18(16)24-15)20-2-4-26-7-11-28-12-8-26/h13-14H,1-12H2,(H2,19,20,22,23,24) |
| InChIKey | HUVZSOJRSGEICY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |