C14H21F2N3S — CID 18278054
1-(2,4-difluorophenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea (PubChem CID 18278054) has the molecular formula C14H21F2N3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
|---|---|
| PubChem CID | 18278054 |
| Molecular Formula | C14H21F2N3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3-(dimethylamino)-2,2-dimethylpropyl]thiourea |
| SMILES | CN(C)CC(C)(C)CNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2N3S/c1-14(2,9-19(3)4)8-17-13(20)18-12-6-5-10(15)7-11(12)16/h5-7H,8-9H2,1-4H3,(H2,17,18,20) |
| InChIKey | OLTRKLKBPCAFGZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|