C15H13ClF2N2S2 — CID 92541328
1-[2-(4-chlorophenyl)sulfanylethyl]-3-(2,4-difluorophenyl)thiourea (PubChem CID 92541328) has the molecular formula C15H13ClF2N2S2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 92541328 |
| Molecular Formula | C15H13ClF2N2S2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(2,4-difluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NCCSc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C15H13ClF2N2S2/c16-10-1-4-12(5-2-10)22-8-7-19-15(21)20-14-6-3-11(17)9-13(14)18/h1-6,9H,7-8H2,(H2,19,20,21) |
| InChIKey | OLCYAJCXBYFLDM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|