C15H14ClFN2S2 — CID 92541324
1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3-fluorophenyl)thiourea (PubChem CID 92541324) has the molecular formula C15H14ClFN2S2 and a molecular weight of 340.88 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3-fluorophenyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 92541324 |
| Molecular Formula | C15H14ClFN2S2 |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3-fluorophenyl)thiourea |
| SMILES | Fc1cccc(NC(=S)NCCSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H14ClFN2S2/c16-11-4-6-14(7-5-11)21-9-8-18-15(20)19-13-3-1-2-12(17)10-13/h1-7,10H,8-9H2,(H2,18,19,20) |
| InChIKey | XNSBUIDPSJUORP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|