C15H13Cl3N2OS — CID 2172172
1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 2172172) has the molecular formula C15H13Cl3N2OS and a molecular weight of 375.71 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 2172172 |
| Molecular Formula | C15H13Cl3N2OS |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2OS/c16-10-1-4-12(5-2-10)22-8-7-19-15(21)20-11-3-6-13(17)14(18)9-11/h1-6,9H,7-8H2,(H2,19,20,21) |
| InChIKey | FLQAPDUMMGXSLX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|