C16H15Cl2N3OS2 — CID 18416526
4-[2-(3,4-dichlorophenyl)sulfanylethylcarbamothioylamino]benzamide (PubChem CID 18416526) has the molecular formula C16H15Cl2N3OS2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)sulfanylethylcarbamothioylamino]benzamide.
| Compound Name | 4-[2-(3,4-dichlorophenyl)sulfanylethylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18416526 |
| Molecular Formula | C16H15Cl2N3OS2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)sulfanylethylcarbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)NCCSc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H15Cl2N3OS2/c17-13-6-5-12(9-14(13)18)24-8-7-20-16(23)21-11-3-1-10(2-4-11)15(19)22/h1-6,9H,7-8H2,(H2,19,22)(H2,20,21,23) |
| InChIKey | PPJMFNKEZGNPAQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|