C15H14BrClN2S2 — CID 100584397
1-(4-bromo-3-chlorophenyl)-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 100584397) has the molecular formula C15H14BrClN2S2 and a molecular weight of 401.78 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 100584397 |
| Molecular Formula | C15H14BrClN2S2 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | S=C(NCCSc1ccccc1)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H14BrClN2S2/c16-13-7-6-11(10-14(13)17)19-15(20)18-8-9-21-12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H2,18,19,20) |
| InChIKey | MCCZLLACYJDXDA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|