C15H13F3N2S — CID 62615080
4-[2-(3,5-difluorophenyl)ethylamino]-3-fluorobenzenecarbothioamide (PubChem CID 62615080) has the molecular formula C15H13F3N2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenyl)ethylamino]-3-fluorobenzenecarbothioamide.
| Compound Name | 4-[2-(3,5-difluorophenyl)ethylamino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 62615080 |
| Molecular Formula | C15H13F3N2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[2-(3,5-difluorophenyl)ethylamino]-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCc2cc(F)cc(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H13F3N2S/c16-11-5-9(6-12(17)8-11)3-4-20-14-2-1-10(15(19)21)7-13(14)18/h1-2,5-8,20H,3-4H2,(H2,19,21) |
| InChIKey | WBIBNBBPULPLRF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|