C11H19N5O3S — CID 83116433
3-[2-(4-amino-2-sulfamoylanilino)ethyl]-1,1-dimethylurea (PubChem CID 83116433) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-[2-(4-amino-2-sulfamoylanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-amino-2-sulfamoylanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116433 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[2-(4-amino-2-sulfamoylanilino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H19N5O3S/c1-16(2)11(17)15-6-5-14-9-4-3-8(12)7-10(9)20(13,18)19/h3-4,7,14H,5-6,12H2,1-2H3,(H,15,17)(H2,13,18,19) |
| InChIKey | KWMGDROFCAOPQG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|