C8H14N4O2S — CID 83013156
5-amino-2-(2,2-dimethylhydrazinyl)benzenesulfonamide (PubChem CID 83013156) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-amino-2-(2,2-dimethylhydrazinyl)benzenesulfonamide.
| Compound Name | 5-amino-2-(2,2-dimethylhydrazinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83013156 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-amino-2-(2,2-dimethylhydrazinyl)benzenesulfonamide |
| SMILES | CN(C)Nc1ccc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H14N4O2S/c1-12(2)11-7-4-3-6(9)5-8(7)15(10,13)14/h3-5,11H,9H2,1-2H3,(H2,10,13,14) |
| InChIKey | MXZDUTSKNGJTQW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|