C10H17N3O3S2 — CID 113494452
5-amino-2-(2-ethylsulfinylethylamino)benzenesulfonamide (PubChem CID 113494452) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-amino-2-(2-ethylsulfinylethylamino)benzenesulfonamide.
| Compound Name | 5-amino-2-(2-ethylsulfinylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 113494452 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-amino-2-(2-ethylsulfinylethylamino)benzenesulfonamide |
| SMILES | CCS(=O)CCNc1ccc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H17N3O3S2/c1-2-17(14)6-5-13-9-4-3-8(11)7-10(9)18(12,15)16/h3-4,7,13H,2,5-6,11H2,1H3,(H2,12,15,16) |
| InChIKey | RLXWGSORDCSSCS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|