C13H11ClF3N3 — CID 103553011
5-chloro-1-N-[(2,4-difluorophenyl)methyl]-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553011) has the molecular formula C13H11ClF3N3 and a molecular weight of 301.70 g/mol. Its IUPAC name is 5-chloro-1-N-[(2,4-difluorophenyl)methyl]-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-[(2,4-difluorophenyl)methyl]-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553011 |
| Molecular Formula | C13H11ClF3N3 |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-chloro-1-N-[(2,4-difluorophenyl)methyl]-6-fluorobenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(NCc2ccc(F)cc2F)c(F)c1Cl |
| InChI | InChI=1S/C13H11ClF3N3/c14-11-9(18)4-10(19)13(12(11)17)20-5-6-1-2-7(15)3-8(6)16/h1-4,20H,5,18-19H2 |
| InChIKey | YHJZBTVIVNAGTK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|