C12H17BrFN3O — CID 103106654
2-(2-amino-5-bromo-4-fluoroanilino)-N-ethyl-N-methylpropanamide (PubChem CID 103106654) has the molecular formula C12H17BrFN3O and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-(2-amino-5-bromo-4-fluoroanilino)-N-ethyl-N-methylpropanamide.
| Compound Name | 2-(2-amino-5-bromo-4-fluoroanilino)-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103106654 |
| Molecular Formula | C12H17BrFN3O |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(2-amino-5-bromo-4-fluoroanilino)-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)Nc1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C12H17BrFN3O/c1-4-17(3)12(18)7(2)16-11-5-8(13)9(14)6-10(11)15/h5-7,16H,4,15H2,1-3H3 |
| InChIKey | NUUMDTKNGNDZIZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|