C9H12ClFN2S — CID 103553880
4-chloro-5-fluoro-6-propan-2-ylsulfanylbenzene-1,3-diamine (PubChem CID 103553880) has the molecular formula C9H12ClFN2S and a molecular weight of 234.73 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-propan-2-ylsulfanylbenzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-propan-2-ylsulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 103553880 |
| Molecular Formula | C9H12ClFN2S |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 4-chloro-5-fluoro-6-propan-2-ylsulfanylbenzene-1,3-diamine |
| SMILES | CC(C)Sc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C9H12ClFN2S/c1-4(2)14-9-6(13)3-5(12)7(10)8(9)11/h3-4H,12-13H2,1-2H3 |
| InChIKey | QSNMCNAWGXIPPH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|