C10H8ClFN4S — CID 103553904
4-chloro-5-fluoro-6-pyrazin-2-ylsulfanylbenzene-1,3-diamine (PubChem CID 103553904) has the molecular formula C10H8ClFN4S and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-pyrazin-2-ylsulfanylbenzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-pyrazin-2-ylsulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 103553904 |
| Molecular Formula | C10H8ClFN4S |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-chloro-5-fluoro-6-pyrazin-2-ylsulfanylbenzene-1,3-diamine |
| SMILES | Nc1cc(N)c(Sc2cnccn2)c(F)c1Cl |
| InChI | InChI=1S/C10H8ClFN4S/c11-8-5(13)3-6(14)10(9(8)12)17-7-4-15-1-2-16-7/h1-4H,13-14H2 |
| InChIKey | QTOURFHWUSEVBD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|