C10H16N2S3 — CID 588965
(2-methyl-1,3-thiazol-4-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 588965) has the molecular formula C10H16N2S3 and a molecular weight of 260.45 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 588965 |
| Molecular Formula | C10H16N2S3 |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1csc(C)n1 |
| InChI | InChI=1S/C10H16N2S3/c1-4-12(5-2)10(13)15-7-9-6-14-8(3)11-9/h6H,4-5,7H2,1-3H3 |
| InChIKey | UEVFHIRMCYPMHU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|