C9H15N3S2 — CID 115587578
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-propylthiourea (PubChem CID 115587578) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-propylthiourea.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 115587578 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCc1csc(C)n1 |
| InChI | InChI=1S/C9H15N3S2/c1-3-4-10-9(13)11-5-8-6-14-7(2)12-8/h6H,3-5H2,1-2H3,(H2,10,11,13) |
| InChIKey | NFXFSQYHTRQAOZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|