C4H4N2S3 — CID 154362539
1,3-thiazol-2-yl carbamodithioate (PubChem CID 154362539) has the molecular formula C4H4N2S3 and a molecular weight of 176.29 g/mol. Its IUPAC name is 1,3-thiazol-2-yl carbamodithioate.
| Compound Name | 1,3-thiazol-2-yl carbamodithioate |
|---|---|
| PubChem CID | 154362539 |
| Molecular Formula | C4H4N2S3 |
| Molecular Weight | 176.29 g/mol |
| Exact Mass | 175.95 |
| IUPAC Name | 1,3-thiazol-2-yl carbamodithioate |
| SMILES | NC(=S)Sc1nccs1 |
| InChI | InChI=1S/C4H4N2S3/c5-3(7)9-4-6-1-2-8-4/h1-2H,(H2,5,7) |
| InChIKey | RUBVUESBRNHFND-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|