C12H2N6S4 — CID 153332643
2-[cyano(1,3-thiazol-2-ylsulfanyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 153332643) has the molecular formula C12H2N6S4 and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[cyano(1,3-thiazol-2-ylsulfanyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-[cyano(1,3-thiazol-2-ylsulfanyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 153332643 |
| Molecular Formula | C12H2N6S4 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 2-[cyano(1,3-thiazol-2-ylsulfanyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | N#CC(Sc1nccs1)=C1Sc2nc(C#N)c(C#N)nc2S1 |
| InChI | InChI=1S/C12H2N6S4/c13-3-6-7(4-14)18-10-9(17-6)21-11(22-10)8(5-15)20-12-16-1-2-19-12/h1-2H |
| InChIKey | UPTDMRAJZAPQIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|