C18H11N5O3S2 — CID 153332736
2-[cyano-(3,4,5-trimethoxyphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 153332736) has the molecular formula C18H11N5O3S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-[cyano-(3,4,5-trimethoxyphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-[cyano-(3,4,5-trimethoxyphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 153332736 |
| Molecular Formula | C18H11N5O3S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-[cyano-(3,4,5-trimethoxyphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | COc1cc(C(C#N)=C2Sc3nc(C#N)c(C#N)nc3S2)cc(OC)c1OC |
| InChI | InChI=1S/C18H11N5O3S2/c1-24-13-4-9(5-14(25-2)15(13)26-3)10(6-19)18-27-16-17(28-18)23-12(8-21)11(7-20)22-16/h4-5H,1-3H3 |
| InChIKey | HCFZGNZCDJQZMA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 124.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|