C17H7N5O3S2 — CID 153332693
(3-methoxyphenyl) 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)acetate (PubChem CID 153332693) has the molecular formula C17H7N5O3S2 and a molecular weight of 393.41 g/mol. Its IUPAC name is (3-methoxyphenyl) 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)acetate.
| Compound Name | (3-methoxyphenyl) 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)acetate |
|---|---|
| PubChem CID | 153332693 |
| Molecular Formula | C17H7N5O3S2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (3-methoxyphenyl) 2-cyano-2-(5,6-dicyano-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)acetate |
| SMILES | COc1cccc(OC(=O)C(C#N)=C2Sc3nc(C#N)c(C#N)nc3S2)c1 |
| InChI | InChI=1S/C17H7N5O3S2/c1-24-9-3-2-4-10(5-9)25-16(23)11(6-18)17-26-14-15(27-17)22-13(8-20)12(7-19)21-14/h2-5H,1H3 |
| InChIKey | DAFYFXKEZALSLL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 132.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|