C7H10N2OS2 — CID 62900689
2-(1,3-thiazol-2-ylsulfanyl)butanamide (PubChem CID 62900689) has the molecular formula C7H10N2OS2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfanyl)butanamide.
| Compound Name | 2-(1,3-thiazol-2-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 62900689 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfanyl)butanamide |
| SMILES | CCC(Sc1nccs1)C(N)=O |
| InChI | InChI=1S/C7H10N2OS2/c1-2-5(6(8)10)12-7-9-3-4-11-7/h3-5H,2H2,1H3,(H2,8,10) |
| InChIKey | RICVZKVBGVEZAS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|