C4H3F2NS2 — CID 173363309
2-(difluoromethylsulfanyl)-1,3-thiazole (PubChem CID 173363309) has the molecular formula C4H3F2NS2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-1,3-thiazole.
| Compound Name | 2-(difluoromethylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 173363309 |
| Molecular Formula | C4H3F2NS2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-1,3-thiazole |
| SMILES | FC(F)Sc1nccs1 |
| InChI | InChI=1S/C4H3F2NS2/c5-3(6)9-4-7-1-2-8-4/h1-3H |
| InChIKey | JDHVSKZSVFOSJQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|